C17H30N4O3S — CID 78303853
7-(2-methoxyethyl)-3-methyl-8-octylsulfanyl-4,5-dihydropurine-2,6-dione (PubChem CID 78303853) has the molecular formula C17H30N4O3S and a molecular weight of 370.52 g/mol. Its IUPAC name is 7-(2-methoxyethyl)-3-methyl-8-octylsulfanyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 7-(2-methoxyethyl)-3-methyl-8-octylsulfanyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 78303853 |
| Molecular Formula | C17H30N4O3S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 7-(2-methoxyethyl)-3-methyl-8-octylsulfanyl-4,5-dihydropurine-2,6-dione |
| SMILES | CCCCCCCCSC1=NC2C(C(=O)NC(=O)N2C)N1CCOC |
| InChI | InChI=1S/C17H30N4O3S/c1-4-5-6-7-8-9-12-25-17-18-14-13(21(17)10-11-24-3)15(22)19-16(23)20(14)2/h13-14H,4-12H2,1-3H3,(H,19,22,23) |
| InChIKey | ZVKVZJNZLJNSCF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|