C20H27ClN4O2S — CID 78303543
7-[(2-chlorophenyl)methyl]-8-heptylsulfanyl-3-methyl-4,5-dihydropurine-2,6-dione (PubChem CID 78303543) has the molecular formula C20H27ClN4O2S and a molecular weight of 422.98 g/mol. Its IUPAC name is 7-[(2-chlorophenyl)methyl]-8-heptylsulfanyl-3-methyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 7-[(2-chlorophenyl)methyl]-8-heptylsulfanyl-3-methyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 78303543 |
| Molecular Formula | C20H27ClN4O2S |
| Molecular Weight | 422.98 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 7-[(2-chlorophenyl)methyl]-8-heptylsulfanyl-3-methyl-4,5-dihydropurine-2,6-dione |
| SMILES | CCCCCCCSC1=NC2C(C(=O)NC(=O)N2C)N1Cc1ccccc1Cl |
| InChI | InChI=1S/C20H27ClN4O2S/c1-3-4-5-6-9-12-28-20-22-17-16(18(26)23-19(27)24(17)2)25(20)13-14-10-7-8-11-15(14)21/h7-8,10-11,16-17H,3-6,9,12-13H2,1-2H3,(H,23,26,27) |
| InChIKey | BIXPVDLMNYKECD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.98 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|