C17H30N4O2S — CID 78303689
7-heptyl-3-methyl-8-(2-methylpropylsulfanyl)-4,5-dihydropurine-2,6-dione (PubChem CID 78303689) has the molecular formula C17H30N4O2S and a molecular weight of 354.52 g/mol. Its IUPAC name is 7-heptyl-3-methyl-8-(2-methylpropylsulfanyl)-4,5-dihydropurine-2,6-dione.
| Compound Name | 7-heptyl-3-methyl-8-(2-methylpropylsulfanyl)-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 78303689 |
| Molecular Formula | C17H30N4O2S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 7-heptyl-3-methyl-8-(2-methylpropylsulfanyl)-4,5-dihydropurine-2,6-dione |
| SMILES | CCCCCCCN1C(SCC(C)C)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C17H30N4O2S/c1-5-6-7-8-9-10-21-13-14(18-17(21)24-11-12(2)3)20(4)16(23)19-15(13)22/h12-14H,5-11H2,1-4H3,(H,19,22,23) |
| InChIKey | KDUHVZHRCPHRKY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|