C19H25N7O6 — CID 74733544
7-[2-hydroxy-3-(4-nitrophenoxy)propyl]-3-methyl-8-piperazin-1-yl-4,5-dihydropurine-2,6-dione (PubChem CID 74733544) has the molecular formula C19H25N7O6 and a molecular weight of 447.45 g/mol. Its IUPAC name is 7-[2-hydroxy-3-(4-nitrophenoxy)propyl]-3-methyl-8-piperazin-1-yl-4,5-dihydropurine-2,6-dione.
| Compound Name | 7-[2-hydroxy-3-(4-nitrophenoxy)propyl]-3-methyl-8-piperazin-1-yl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 74733544 |
| Molecular Formula | C19H25N7O6 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 7-[2-hydroxy-3-(4-nitrophenoxy)propyl]-3-methyl-8-piperazin-1-yl-4,5-dihydropurine-2,6-dione |
| SMILES | CN1C(=O)NC(=O)C2C1N=C(N1CCNCC1)N2CC(O)COc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H25N7O6/c1-23-16-15(17(28)22-19(23)29)25(18(21-16)24-8-6-20-7-9-24)10-13(27)11-32-14-4-2-12(3-5-14)26(30)31/h2-5,13,15-16,20,27H,6-11H2,1H3,(H,22,28,29) |
| InChIKey | AIPXPCGBDJMALC-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 152.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|