C13H12BrN5O4 — CID 78215169
8-bromo-3-methyl-7-[(4-nitrophenyl)methyl]-4,5-dihydropurine-2,6-dione (PubChem CID 78215169) has the molecular formula C13H12BrN5O4 and a molecular weight of 382.17 g/mol. Its IUPAC name is 8-bromo-3-methyl-7-[(4-nitrophenyl)methyl]-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-bromo-3-methyl-7-[(4-nitrophenyl)methyl]-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 78215169 |
| Molecular Formula | C13H12BrN5O4 |
| Molecular Weight | 382.17 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | 8-bromo-3-methyl-7-[(4-nitrophenyl)methyl]-4,5-dihydropurine-2,6-dione |
| SMILES | CN1C(=O)NC(=O)C2C1N=C(Br)N2Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H12BrN5O4/c1-17-10-9(11(20)16-13(17)21)18(12(14)15-10)6-7-2-4-8(5-3-7)19(22)23/h2-5,9-10H,6H2,1H3,(H,16,20,21) |
| InChIKey | HATWMFJAYJMOOW-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 108.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.17 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|