C13H14N5O4+ — CID 7784491
(4R,5S)-3-methyl-7-[(4-nitrophenyl)methyl]-5,9-dihydro-4H-purin-7-ium-2,6-dione (PubChem CID 7784491) has the molecular formula C13H14N5O4+ and a molecular weight of 304.29 g/mol. Its IUPAC name is (4R,5S)-3-methyl-7-[(4-nitrophenyl)methyl]-5,9-dihydro-4H-purin-7-ium-2,6-dione.
| Compound Name | (4R,5S)-3-methyl-7-[(4-nitrophenyl)methyl]-5,9-dihydro-4H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 7784491 |
| Molecular Formula | C13H14N5O4+ |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | (4R,5S)-3-methyl-7-[(4-nitrophenyl)methyl]-5,9-dihydro-4H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)NC(=O)[C@@H]2[C@@H]1NC=[N+]2Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H13N5O4/c1-16-11-10(12(19)15-13(16)20)17(7-14-11)6-8-2-4-9(5-3-8)18(21)22/h2-5,7,10-11H,6H2,1H3,(H,15,19,20)/p+1/t10-,11+/m0/s1 |
| InChIKey | DEXOOQCIAHWHQF-WDEREUQCSA-O |
| XLogP | -0.38 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|