C10H10N4O3 — CID 11128220
2-amino-4-[(4-nitrophenyl)methyl]-1,4-dihydroimidazol-5-one (PubChem CID 11128220) has the molecular formula C10H10N4O3 and a molecular weight of 234.22 g/mol. Its IUPAC name is 2-amino-4-[(4-nitrophenyl)methyl]-1,4-dihydroimidazol-5-one.
| Compound Name | 2-amino-4-[(4-nitrophenyl)methyl]-1,4-dihydroimidazol-5-one |
|---|---|
| PubChem CID | 11128220 |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 2-amino-4-[(4-nitrophenyl)methyl]-1,4-dihydroimidazol-5-one |
| SMILES | NC1=NC(Cc2ccc([N+](=O)[O-])cc2)C(=O)N1 |
| InChI | InChI=1S/C10H10N4O3/c11-10-12-8(9(15)13-10)5-6-1-3-7(4-2-6)14(16)17/h1-4,8H,5H2,(H3,11,12,13,15) |
| InChIKey | RKDCGFLLXXXFDL-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|