C10H6N2O5 — CID 117060490
4-(4-nitrophenyl)pyrrolidine-2,3,5-trione (PubChem CID 117060490) has the molecular formula C10H6N2O5 and a molecular weight of 234.17 g/mol. Its IUPAC name is 4-(4-nitrophenyl)pyrrolidine-2,3,5-trione.
| Compound Name | 4-(4-nitrophenyl)pyrrolidine-2,3,5-trione |
|---|---|
| PubChem CID | 117060490 |
| Molecular Formula | C10H6N2O5 |
| Molecular Weight | 234.17 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 4-(4-nitrophenyl)pyrrolidine-2,3,5-trione |
| SMILES | O=C1NC(=O)C(c2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C10H6N2O5/c13-8-7(9(14)11-10(8)15)5-1-3-6(4-2-5)12(16)17/h1-4,7H,(H,11,14,15) |
| InChIKey | MSRWHQLJQCSCKJ-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.17 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|