C20H11N7O4 — CID 15317678
2,5-bis(4-nitrophenyl)pyrrolidine-3,3,4,4-tetracarbonitrile (PubChem CID 15317678) has the molecular formula C20H11N7O4 and a molecular weight of 413.35 g/mol. Its IUPAC name is 2,5-bis(4-nitrophenyl)pyrrolidine-3,3,4,4-tetracarbonitrile.
| Compound Name | 2,5-bis(4-nitrophenyl)pyrrolidine-3,3,4,4-tetracarbonitrile |
|---|---|
| PubChem CID | 15317678 |
| Molecular Formula | C20H11N7O4 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 2,5-bis(4-nitrophenyl)pyrrolidine-3,3,4,4-tetracarbonitrile |
| SMILES | N#CC1(C#N)C(c2ccc([N+](=O)[O-])cc2)NC(c2ccc([N+](=O)[O-])cc2)C1(C#N)C#N |
| InChI | InChI=1S/C20H11N7O4/c21-9-19(10-22)17(13-1-5-15(6-2-13)26(28)29)25-18(20(19,11-23)12-24)14-3-7-16(8-4-14)27(30)31/h1-8,17-18,25H |
| InChIKey | QNAKPMZAIRRTQW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 193.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|