C15H10N6O6 — CID 44623462
9-(4-nitrophenyl)-2,4,6,12,14-pentazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8)-diene-5,7,11,13-tetrone (PubChem CID 44623462) has the molecular formula C15H10N6O6 and a molecular weight of 370.28 g/mol. Its IUPAC name is 9-(4-nitrophenyl)-2,4,6,12,14-pentazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8)-diene-5,7,11,13-tetrone.
| Compound Name | 9-(4-nitrophenyl)-2,4,6,12,14-pentazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8)-diene-5,7,11,13-tetrone |
|---|---|
| PubChem CID | 44623462 |
| Molecular Formula | C15H10N6O6 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 9-(4-nitrophenyl)-2,4,6,12,14-pentazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8)-diene-5,7,11,13-tetrone |
| SMILES | O=c1[nH]c2c(c(=O)[nH]1)C(c1ccc([N+](=O)[O-])cc1)c1c([nH]c(=O)[nH]c1=O)N2 |
| InChI | InChI=1S/C15H10N6O6/c22-12-8-7(5-1-3-6(4-2-5)21(26)27)9-11(18-15(25)20-13(9)23)16-10(8)17-14(24)19-12/h1-4,7H,(H5,16,17,18,19,20,22,23,24,25) |
| InChIKey | PUVZBIFHPUKDRK-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 186.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|