C18H16N4O6 — CID 23771128
prop-2-enyl 7-methyl-5-(4-nitrophenyl)-2,4-dioxo-5,8-dihydro-1H-pyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 23771128) has the molecular formula C18H16N4O6 and a molecular weight of 384.35 g/mol. Its IUPAC name is prop-2-enyl 7-methyl-5-(4-nitrophenyl)-2,4-dioxo-5,8-dihydro-1H-pyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | prop-2-enyl 7-methyl-5-(4-nitrophenyl)-2,4-dioxo-5,8-dihydro-1H-pyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 23771128 |
| Molecular Formula | C18H16N4O6 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | prop-2-enyl 7-methyl-5-(4-nitrophenyl)-2,4-dioxo-5,8-dihydro-1H-pyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | C=CCOC(=O)C1=C(C)Nc2[nH]c(=O)[nH]c(=O)c2C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H16N4O6/c1-3-8-28-17(24)12-9(2)19-15-14(16(23)21-18(25)20-15)13(12)10-4-6-11(7-5-10)22(26)27/h3-7,13H,1,8H2,2H3,(H3,19,20,21,23,25) |
| InChIKey | PRSKIWVBCVWVDJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 147.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|