C15H16N4O4 — CID 4111258
2,6-dimethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide (PubChem CID 4111258) has the molecular formula C15H16N4O4 and a molecular weight of 316.32 g/mol. Its IUPAC name is 2,6-dimethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide.
| Compound Name | 2,6-dimethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 4111258 |
| Molecular Formula | C15H16N4O4 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2,6-dimethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide |
| SMILES | CC1=C(C(N)=O)C(c2ccc([N+](=O)[O-])cc2)C(C(N)=O)=C(C)N1 |
| InChI | InChI=1S/C15H16N4O4/c1-7-11(14(16)20)13(12(15(17)21)8(2)18-7)9-3-5-10(6-4-9)19(22)23/h3-6,13,18H,1-2H3,(H2,16,20)(H2,17,21) |
| InChIKey | VRMZVFBIYGGBMZ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 141.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|