C32H40N6O5 — CID 10698608
5-N-[3-[4-(dimethylcarbamoyl)-4-phenylpiperidin-1-yl]propyl]-2,6-dimethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide (PubChem CID 10698608) has the molecular formula C32H40N6O5 and a molecular weight of 588.71 g/mol. Its IUPAC name is 5-N-[3-[4-(dimethylcarbamoyl)-4-phenylpiperidin-1-yl]propyl]-2,6-dimethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide.
| Compound Name | 5-N-[3-[4-(dimethylcarbamoyl)-4-phenylpiperidin-1-yl]propyl]-2,6-dimethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 10698608 |
| Molecular Formula | C32H40N6O5 |
| Molecular Weight | 588.71 g/mol |
| Exact Mass | 588.31 |
| IUPAC Name | 5-N-[3-[4-(dimethylcarbamoyl)-4-phenylpiperidin-1-yl]propyl]-2,6-dimethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide |
| SMILES | CC1=C(C(N)=O)C(c2ccc([N+](=O)[O-])cc2)C(C(=O)NCCCN2CCC(C(=O)N(C)C)(c3ccccc3)CC2)=C(C)N1 |
| InChI | InChI=1S/C32H40N6O5/c1-21-26(29(33)39)28(23-11-13-25(14-12-23)38(42)43)27(22(2)35-21)30(40)34-17-8-18-37-19-15-32(16-20-37,31(41)36(3)4)24-9-6-5-7-10-24/h5-7,9-14,28,35H,8,15-20H2,1-4H3,(H2,33,39)(H,34,40) |
| InChIKey | LEPCEIHDKKWUSM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 150.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.71 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|