C40H51N5O4 — CID 159347263
5-N-[3-(4,4-diphenylpiperidin-1-yl)propyl]-3-N,2,6-triethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide;methane (PubChem CID 159347263) has the molecular formula C40H51N5O4 and a molecular weight of 665.88 g/mol. Its IUPAC name is 5-N-[3-(4,4-diphenylpiperidin-1-yl)propyl]-3-N,2,6-triethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide;methane.
| Compound Name | 5-N-[3-(4,4-diphenylpiperidin-1-yl)propyl]-3-N,2,6-triethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide;methane |
|---|---|
| PubChem CID | 159347263 |
| Molecular Formula | C40H51N5O4 |
| Molecular Weight | 665.88 g/mol |
| Exact Mass | 665.39 |
| IUPAC Name | 5-N-[3-(4,4-diphenylpiperidin-1-yl)propyl]-3-N,2,6-triethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide;methane |
| SMILES | C.CCNC(=O)C1=C(CC)NC(CC)=C(C(=O)NCCCN2CCC(c3ccccc3)(c3ccccc3)CC2)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C39H47N5O4.CH4/c1-4-32-35(37(45)40-6-3)34(28-18-20-31(21-19-28)44(47)48)36(33(5-2)42-32)38(46)41-24-13-25-43-26-22-39(23-27-43,29-14-9-7-10-15-29)30-16-11-8-12-17-30;/h7-12,14-21,34,42H,4-6,13,22-27H2,1-3H3,(H,40,45)(H,41,46);1H4 |
| InChIKey | JAQIUHLKCRUAGW-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.88 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|