C32H40N6O4 — CID 20642222
2,6-diethyl-5-N-[3-(4-methanimidoyl-4-phenylpiperidin-1-yl)propyl]-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide (PubChem CID 20642222) has the molecular formula C32H40N6O4 and a molecular weight of 572.71 g/mol. Its IUPAC name is 2,6-diethyl-5-N-[3-(4-methanimidoyl-4-phenylpiperidin-1-yl)propyl]-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide.
| Compound Name | 2,6-diethyl-5-N-[3-(4-methanimidoyl-4-phenylpiperidin-1-yl)propyl]-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 20642222 |
| Molecular Formula | C32H40N6O4 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.31 |
| IUPAC Name | 2,6-diethyl-5-N-[3-(4-methanimidoyl-4-phenylpiperidin-1-yl)propyl]-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide |
| SMILES | [H]/N=C/C1(c2ccccc2)CCN(CCCNC(=O)C2=C(CC)NC(CC)=C(C(N)=O)C2c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C32H40N6O4/c1-3-25-28(30(34)39)27(22-11-13-24(14-12-22)38(41)42)29(26(4-2)36-25)31(40)35-17-8-18-37-19-15-32(21-33,16-20-37)23-9-6-5-7-10-23/h5-7,9-14,21,27,33,36H,3-4,8,15-20H2,1-2H3,(H2,34,39)(H,35,40)/b33-21+ |
| InChIKey | TZYGCUFKXXLEQL-QNKGDIEWSA-N |
| XLogP | 4.28 |
| TPSA | 154.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|