C34H38N4O5Si — CID 11181024
5-[3-(4,4-diphenyl-1,4-azasilinan-1-yl)propylcarbamoyl]-2,6-dimethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid (PubChem CID 11181024) has the molecular formula C34H38N4O5Si and a molecular weight of 610.79 g/mol. Its IUPAC name is 5-[3-(4,4-diphenyl-1,4-azasilinan-1-yl)propylcarbamoyl]-2,6-dimethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid.
| Compound Name | 5-[3-(4,4-diphenyl-1,4-azasilinan-1-yl)propylcarbamoyl]-2,6-dimethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 11181024 |
| Molecular Formula | C34H38N4O5Si |
| Molecular Weight | 610.79 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | 5-[3-(4,4-diphenyl-1,4-azasilinan-1-yl)propylcarbamoyl]-2,6-dimethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2ccc([N+](=O)[O-])cc2)C(C(=O)NCCCN2CC[Si](c3ccccc3)(c3ccccc3)CC2)=C(C)N1 |
| InChI | InChI=1S/C34H38N4O5Si/c1-24-30(32(31(34(40)41)25(2)36-24)26-14-16-27(17-15-26)38(42)43)33(39)35-18-9-19-37-20-22-44(23-21-37,28-10-5-3-6-11-28)29-12-7-4-8-13-29/h3-8,10-17,32,36H,9,18-23H2,1-2H3,(H,35,39)(H,40,41) |
| InChIKey | ADCBKQGEPKXRSY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 124.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.79 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|