C39H49N5O4 — CID 160647575
5-N-[3-(4,4-diphenylpiperidin-1-yl)propyl]-2,6-diethyl-3-N-methyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide;methane (PubChem CID 160647575) has the molecular formula C39H49N5O4 and a molecular weight of 651.85 g/mol. Its IUPAC name is 5-N-[3-(4,4-diphenylpiperidin-1-yl)propyl]-2,6-diethyl-3-N-methyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide;methane.
| Compound Name | 5-N-[3-(4,4-diphenylpiperidin-1-yl)propyl]-2,6-diethyl-3-N-methyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide;methane |
|---|---|
| PubChem CID | 160647575 |
| Molecular Formula | C39H49N5O4 |
| Molecular Weight | 651.85 g/mol |
| Exact Mass | 651.38 |
| IUPAC Name | 5-N-[3-(4,4-diphenylpiperidin-1-yl)propyl]-2,6-diethyl-3-N-methyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide;methane |
| SMILES | C.CCC1=C(C(=O)NC)C(c2ccc([N+](=O)[O-])cc2)C(C(=O)NCCCN2CCC(c3ccccc3)(c3ccccc3)CC2)=C(CC)N1 |
| InChI | InChI=1S/C38H45N5O4.CH4/c1-4-31-34(36(44)39-3)33(27-17-19-30(20-18-27)43(46)47)35(32(5-2)41-31)37(45)40-23-12-24-42-25-21-38(22-26-42,28-13-8-6-9-14-28)29-15-10-7-11-16-29;/h6-11,13-20,33,41H,4-5,12,21-26H2,1-3H3,(H,39,44)(H,40,45);1H4 |
| InChIKey | XOEUWEVFSCIKMZ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.85 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|