C37H43N5O5 — CID 91931164
5-N-[3-(4,4-diphenylpiperidin-1-yl)propyl]-2-ethyl-6-(methoxymethyl)-4-(4-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxamide (PubChem CID 91931164) has the molecular formula C37H43N5O5 and a molecular weight of 637.78 g/mol. Its IUPAC name is 5-N-[3-(4,4-diphenylpiperidin-1-yl)propyl]-2-ethyl-6-(methoxymethyl)-4-(4-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxamide.
| Compound Name | 5-N-[3-(4,4-diphenylpiperidin-1-yl)propyl]-2-ethyl-6-(methoxymethyl)-4-(4-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 91931164 |
| Molecular Formula | C37H43N5O5 |
| Molecular Weight | 637.78 g/mol |
| Exact Mass | 637.33 |
| IUPAC Name | 5-N-[3-(4,4-diphenylpiperidin-1-yl)propyl]-2-ethyl-6-(methoxymethyl)-4-(4-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxamide |
| SMILES | CCC1=NC(COC)=C(C(=O)NCCCN2CCC(c3ccccc3)(c3ccccc3)CC2)C(c2ccc([N+](=O)[O-])cc2)C1C(N)=O |
| InChI | InChI=1S/C37H43N5O5/c1-3-30-33(35(38)43)32(26-15-17-29(18-16-26)42(45)46)34(31(40-30)25-47-2)36(44)39-21-10-22-41-23-19-37(20-24-41,27-11-6-4-7-12-27)28-13-8-5-9-14-28/h4-9,11-18,32-33H,3,10,19-25H2,1-2H3,(H2,38,43)(H,39,44) |
| InChIKey | SPIJYUMJUFXBOQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 140.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.78 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|