C30H36ClN5O5 — CID 91596289
5-N-[3-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]propyl]-6-ethyl-2-methyl-4-(4-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxamide (PubChem CID 91596289) has the molecular formula C30H36ClN5O5 and a molecular weight of 582.10 g/mol. Its IUPAC name is 5-N-[3-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]propyl]-6-ethyl-2-methyl-4-(4-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxamide.
| Compound Name | 5-N-[3-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]propyl]-6-ethyl-2-methyl-4-(4-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 91596289 |
| Molecular Formula | C30H36ClN5O5 |
| Molecular Weight | 582.10 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | 5-N-[3-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]propyl]-6-ethyl-2-methyl-4-(4-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxamide |
| SMILES | CCC1=C(C(=O)NCCCN2CCC(O)(c3ccc(Cl)cc3)CC2)C(c2ccc([N+](=O)[O-])cc2)C(C(N)=O)C(C)=N1 |
| InChI | InChI=1S/C30H36ClN5O5/c1-3-24-27(26(25(28(32)37)19(2)34-24)20-5-11-23(12-6-20)36(40)41)29(38)33-15-4-16-35-17-13-30(39,14-18-35)21-7-9-22(31)10-8-21/h5-12,25-26,39H,3-4,13-18H2,1-2H3,(H2,32,37)(H,33,38) |
| InChIKey | WGWNNKIBAHWLOX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 151.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.10 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|