C33H41N5O7 — CID 54181835
2-methoxyethyl 1-[3-[[3-carbamoyl-2,6-dimethyl-4-(4-nitrophenyl)-3,4-dihydropyridine-5-carbonyl]amino]propyl]-4-phenylpiperidine-4-carboxylate (PubChem CID 54181835) has the molecular formula C33H41N5O7 and a molecular weight of 619.72 g/mol. Its IUPAC name is 2-methoxyethyl 1-[3-[[3-carbamoyl-2,6-dimethyl-4-(4-nitrophenyl)-3,4-dihydropyridine-5-carbonyl]amino]propyl]-4-phenylpiperidine-4-carboxylate.
| Compound Name | 2-methoxyethyl 1-[3-[[3-carbamoyl-2,6-dimethyl-4-(4-nitrophenyl)-3,4-dihydropyridine-5-carbonyl]amino]propyl]-4-phenylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 54181835 |
| Molecular Formula | C33H41N5O7 |
| Molecular Weight | 619.72 g/mol |
| Exact Mass | 619.30 |
| IUPAC Name | 2-methoxyethyl 1-[3-[[3-carbamoyl-2,6-dimethyl-4-(4-nitrophenyl)-3,4-dihydropyridine-5-carbonyl]amino]propyl]-4-phenylpiperidine-4-carboxylate |
| SMILES | COCCOC(=O)C1(c2ccccc2)CCN(CCCNC(=O)C2=C(C)N=C(C)C(C(N)=O)C2c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C33H41N5O7/c1-22-27(30(34)39)29(24-10-12-26(13-11-24)38(42)43)28(23(2)36-22)31(40)35-16-7-17-37-18-14-33(15-19-37,25-8-5-4-6-9-25)32(41)45-21-20-44-3/h4-6,8-13,27,29H,7,14-21H2,1-3H3,(H2,34,39)(H,35,40) |
| InChIKey | PCIZVLJNIBVUFB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 166.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.72 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|