C36H40N4O6 — CID 57296298
5-O-[3-(4,4-diphenylpiperidin-1-yl)propyl] 3-O-ethyl 2-amino-6-methyl-4-(4-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 57296298) has the molecular formula C36H40N4O6 and a molecular weight of 624.74 g/mol. Its IUPAC name is 5-O-[3-(4,4-diphenylpiperidin-1-yl)propyl] 3-O-ethyl 2-amino-6-methyl-4-(4-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[3-(4,4-diphenylpiperidin-1-yl)propyl] 3-O-ethyl 2-amino-6-methyl-4-(4-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 57296298 |
| Molecular Formula | C36H40N4O6 |
| Molecular Weight | 624.74 g/mol |
| Exact Mass | 624.29 |
| IUPAC Name | 5-O-[3-(4,4-diphenylpiperidin-1-yl)propyl] 3-O-ethyl 2-amino-6-methyl-4-(4-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1C(N)=NC(C)=C(C(=O)OCCCN2CCC(c3ccccc3)(c3ccccc3)CC2)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C36H40N4O6/c1-3-45-35(42)32-31(26-15-17-29(18-16-26)40(43)44)30(25(2)38-33(32)37)34(41)46-24-10-21-39-22-19-36(20-23-39,27-11-6-4-7-12-27)28-13-8-5-9-14-28/h4-9,11-18,31-32H,3,10,19-24H2,1-2H3,(H2,37,38) |
| InChIKey | ZZVVOIOXFFAWCZ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 137.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.74 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|