C39H47N5O4 — CID 90747966
N-[5-[3-(4,4-diphenylpiperidin-1-yl)propyl-formylamino]-2,6-diethyl-4-(4-nitrophenyl)-3,4-dihydropyridin-3-yl]-N-ethylformamide (PubChem CID 90747966) has the molecular formula C39H47N5O4 and a molecular weight of 649.84 g/mol. Its IUPAC name is N-[5-[3-(4,4-diphenylpiperidin-1-yl)propyl-formylamino]-2,6-diethyl-4-(4-nitrophenyl)-3,4-dihydropyridin-3-yl]-N-ethylformamide.
| Compound Name | N-[5-[3-(4,4-diphenylpiperidin-1-yl)propyl-formylamino]-2,6-diethyl-4-(4-nitrophenyl)-3,4-dihydropyridin-3-yl]-N-ethylformamide |
|---|---|
| PubChem CID | 90747966 |
| Molecular Formula | C39H47N5O4 |
| Molecular Weight | 649.84 g/mol |
| Exact Mass | 649.36 |
| IUPAC Name | N-[5-[3-(4,4-diphenylpiperidin-1-yl)propyl-formylamino]-2,6-diethyl-4-(4-nitrophenyl)-3,4-dihydropyridin-3-yl]-N-ethylformamide |
| SMILES | CCC1=NC(CC)=C(N(C=O)CCCN2CCC(c3ccccc3)(c3ccccc3)CC2)C(c2ccc([N+](=O)[O-])cc2)C1N(C=O)CC |
| InChI | InChI=1S/C39H47N5O4/c1-4-34-37(42(6-3)28-45)36(30-18-20-33(21-19-30)44(47)48)38(35(5-2)40-34)43(29-46)25-13-24-41-26-22-39(23-27-41,31-14-9-7-10-15-31)32-16-11-8-12-17-32/h7-12,14-21,28-29,36-37H,4-6,13,22-27H2,1-3H3 |
| InChIKey | VBMLLKARPUZOSQ-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 99.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.84 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|