C34H43N5O6 — CID 91309693
methyl 1-[3-[[2,6-diethyl-3-[formyl(methyl)amino]-4-(4-nitrophenyl)-3,4-dihydropyridin-5-yl]-formylamino]propyl]-4-phenylpiperidine-4-carboxylate (PubChem CID 91309693) has the molecular formula C34H43N5O6 and a molecular weight of 617.75 g/mol. Its IUPAC name is methyl 1-[3-[[2,6-diethyl-3-[formyl(methyl)amino]-4-(4-nitrophenyl)-3,4-dihydropyridin-5-yl]-formylamino]propyl]-4-phenylpiperidine-4-carboxylate.
| Compound Name | methyl 1-[3-[[2,6-diethyl-3-[formyl(methyl)amino]-4-(4-nitrophenyl)-3,4-dihydropyridin-5-yl]-formylamino]propyl]-4-phenylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 91309693 |
| Molecular Formula | C34H43N5O6 |
| Molecular Weight | 617.75 g/mol |
| Exact Mass | 617.32 |
| IUPAC Name | methyl 1-[3-[[2,6-diethyl-3-[formyl(methyl)amino]-4-(4-nitrophenyl)-3,4-dihydropyridin-5-yl]-formylamino]propyl]-4-phenylpiperidine-4-carboxylate |
| SMILES | CCC1=NC(CC)=C(N(C=O)CCCN2CCC(C(=O)OC)(c3ccccc3)CC2)C(c2ccc([N+](=O)[O-])cc2)C1N(C)C=O |
| InChI | InChI=1S/C34H43N5O6/c1-5-28-31(36(3)23-40)30(25-13-15-27(16-14-25)39(43)44)32(29(6-2)35-28)38(24-41)20-10-19-37-21-17-34(18-22-37,33(42)45-4)26-11-8-7-9-12-26/h7-9,11-16,23-24,30-31H,5-6,10,17-22H2,1-4H3 |
| InChIKey | JKPUHUWUFXFWOB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 125.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.75 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|