C30H35N5O9 — CID 87957638
methyl 3-[hydroxy-[3-(4-methoxycarbonyl-4-phenylpiperidin-1-yl)propyl]carbamoyl]-6-methyl-4-(4-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 87957638) has the molecular formula C30H35N5O9 and a molecular weight of 609.64 g/mol. Its IUPAC name is methyl 3-[hydroxy-[3-(4-methoxycarbonyl-4-phenylpiperidin-1-yl)propyl]carbamoyl]-6-methyl-4-(4-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | methyl 3-[hydroxy-[3-(4-methoxycarbonyl-4-phenylpiperidin-1-yl)propyl]carbamoyl]-6-methyl-4-(4-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 87957638 |
| Molecular Formula | C30H35N5O9 |
| Molecular Weight | 609.64 g/mol |
| Exact Mass | 609.24 |
| IUPAC Name | methyl 3-[hydroxy-[3-(4-methoxycarbonyl-4-phenylpiperidin-1-yl)propyl]carbamoyl]-6-methyl-4-(4-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(C)NC(=O)N(C(=O)N(O)CCCN2CCC(C(=O)OC)(c3ccccc3)CC2)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H35N5O9/c1-20-24(26(36)43-2)25(21-10-12-23(13-11-21)35(41)42)34(28(38)31-20)29(39)33(40)17-7-16-32-18-14-30(15-19-32,27(37)44-3)22-8-5-4-6-9-22/h4-6,8-13,25,40H,7,14-19H2,1-3H3,(H,31,38) |
| InChIKey | PFYOWTGNLAPNQT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 171.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.64 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|