C28H30N4O5 — CID 90998953
methyl 1-[3-[formyl-[4-(4-nitrophenyl)-2-pyridinyl]amino]propyl]-4-phenylpiperidine-4-carboxylate (PubChem CID 90998953) has the molecular formula C28H30N4O5 and a molecular weight of 502.57 g/mol. Its IUPAC name is methyl 1-[3-[formyl-[4-(4-nitrophenyl)-2-pyridinyl]amino]propyl]-4-phenylpiperidine-4-carboxylate.
| Compound Name | methyl 1-[3-[formyl-[4-(4-nitrophenyl)-2-pyridinyl]amino]propyl]-4-phenylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 90998953 |
| Molecular Formula | C28H30N4O5 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | methyl 1-[3-[formyl-[4-(4-nitrophenyl)-2-pyridinyl]amino]propyl]-4-phenylpiperidine-4-carboxylate |
| SMILES | COC(=O)C1(c2ccccc2)CCN(CCCN(C=O)c2cc(-c3ccc([N+](=O)[O-])cc3)ccn2)CC1 |
| InChI | InChI=1S/C28H30N4O5/c1-37-27(34)28(24-6-3-2-4-7-24)13-18-30(19-14-28)16-5-17-31(21-33)26-20-23(12-15-29-26)22-8-10-25(11-9-22)32(35)36/h2-4,6-12,15,20-21H,5,13-14,16-19H2,1H3 |
| InChIKey | RRCMFBQHWORWIO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 105.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|