C38H45N5O5 — CID 54217574
N-[3-acetyl-6-(2-aminoethoxymethyl)-2-methyl-4-(4-nitrophenyl)-3,4-dihydropyridin-5-yl]-N-[3-(4,4-diphenylpiperidin-1-yl)propyl]formamide (PubChem CID 54217574) has the molecular formula C38H45N5O5 and a molecular weight of 651.81 g/mol. Its IUPAC name is N-[3-acetyl-6-(2-aminoethoxymethyl)-2-methyl-4-(4-nitrophenyl)-3,4-dihydropyridin-5-yl]-N-[3-(4,4-diphenylpiperidin-1-yl)propyl]formamide.
| Compound Name | N-[3-acetyl-6-(2-aminoethoxymethyl)-2-methyl-4-(4-nitrophenyl)-3,4-dihydropyridin-5-yl]-N-[3-(4,4-diphenylpiperidin-1-yl)propyl]formamide |
|---|---|
| PubChem CID | 54217574 |
| Molecular Formula | C38H45N5O5 |
| Molecular Weight | 651.81 g/mol |
| Exact Mass | 651.34 |
| IUPAC Name | N-[3-acetyl-6-(2-aminoethoxymethyl)-2-methyl-4-(4-nitrophenyl)-3,4-dihydropyridin-5-yl]-N-[3-(4,4-diphenylpiperidin-1-yl)propyl]formamide |
| SMILES | CC(=O)C1C(C)=NC(COCCN)=C(N(C=O)CCCN2CCC(c3ccccc3)(c3ccccc3)CC2)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C38H45N5O5/c1-28-35(29(2)45)36(30-14-16-33(17-15-30)43(46)47)37(34(40-28)26-48-25-20-39)42(27-44)22-9-21-41-23-18-38(19-24-41,31-10-5-3-6-11-31)32-12-7-4-8-13-32/h3-8,10-17,27,35-36H,9,18-26,39H2,1-2H3 |
| InChIKey | QAHJIOZEQZWMGA-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 131.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.81 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|