C31H40N6O5 — CID 54190841
N-[2,6-diethyl-5-[formyl-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]amino]-4-(4-nitrophenyl)-3,4-dihydropyridin-3-yl]formamide (PubChem CID 54190841) has the molecular formula C31H40N6O5 and a molecular weight of 576.70 g/mol. Its IUPAC name is N-[2,6-diethyl-5-[formyl-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]amino]-4-(4-nitrophenyl)-3,4-dihydropyridin-3-yl]formamide.
| Compound Name | N-[2,6-diethyl-5-[formyl-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]amino]-4-(4-nitrophenyl)-3,4-dihydropyridin-3-yl]formamide |
|---|---|
| PubChem CID | 54190841 |
| Molecular Formula | C31H40N6O5 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | N-[2,6-diethyl-5-[formyl-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]amino]-4-(4-nitrophenyl)-3,4-dihydropyridin-3-yl]formamide |
| SMILES | CCC1=NC(CC)=C(N(C=O)CCCN2CCN(c3ccccc3OC)CC2)C(c2ccc([N+](=O)[O-])cc2)C1NC=O |
| InChI | InChI=1S/C31H40N6O5/c1-4-25-30(32-21-38)29(23-11-13-24(14-12-23)37(40)41)31(26(5-2)33-25)36(22-39)16-8-15-34-17-19-35(20-18-34)27-9-6-7-10-28(27)42-3/h6-7,9-14,21-22,29-30H,4-5,8,15-20H2,1-3H3,(H,32,38) |
| InChIKey | PIJXGGROMOCYBY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|