C28H31BrClN3O4 — CID 46219288
1-[3-[2-[(E)-2-(2-bromophenyl)ethenyl]-4-nitrophenoxy]propyl]-4-(2-methoxyphenyl)piperazine;hydrochloride (PubChem CID 46219288) has the molecular formula C28H31BrClN3O4 and a molecular weight of 588.93 g/mol. Its IUPAC name is 1-[3-[2-[(E)-2-(2-bromophenyl)ethenyl]-4-nitrophenoxy]propyl]-4-(2-methoxyphenyl)piperazine;hydrochloride.
| Compound Name | 1-[3-[2-[(E)-2-(2-bromophenyl)ethenyl]-4-nitrophenoxy]propyl]-4-(2-methoxyphenyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 46219288 |
| Molecular Formula | C28H31BrClN3O4 |
| Molecular Weight | 588.93 g/mol |
| Exact Mass | 587.12 |
| IUPAC Name | 1-[3-[2-[(E)-2-(2-bromophenyl)ethenyl]-4-nitrophenoxy]propyl]-4-(2-methoxyphenyl)piperazine;hydrochloride |
| SMILES | COc1ccccc1N1CCN(CCCOc2ccc([N+](=O)[O-])cc2/C=C/c2ccccc2Br)CC1.Cl |
| InChI | InChI=1S/C28H30BrN3O4.ClH/c1-35-28-10-5-4-9-26(28)31-18-16-30(17-19-31)15-6-20-36-27-14-13-24(32(33)34)21-23(27)12-11-22-7-2-3-8-25(22)29;/h2-5,7-14,21H,6,15-20H2,1H3;1H/b12-11+; |
| InChIKey | FWJMTODHCAZDIL-CALJPSDSSA-N |
| XLogP | 6.55 |
| TPSA | 68.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.93 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|