C31H38N4O5 — CID 91203990
methyl 5-[formyl-[4-(4-phenylpiperidin-1-yl)butyl]amino]-2,6-dimethyl-4-(4-nitrophenyl)-3,4-dihydropyridine-3-carboxylate (PubChem CID 91203990) has the molecular formula C31H38N4O5 and a molecular weight of 546.67 g/mol. Its IUPAC name is methyl 5-[formyl-[4-(4-phenylpiperidin-1-yl)butyl]amino]-2,6-dimethyl-4-(4-nitrophenyl)-3,4-dihydropyridine-3-carboxylate.
| Compound Name | methyl 5-[formyl-[4-(4-phenylpiperidin-1-yl)butyl]amino]-2,6-dimethyl-4-(4-nitrophenyl)-3,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 91203990 |
| Molecular Formula | C31H38N4O5 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | methyl 5-[formyl-[4-(4-phenylpiperidin-1-yl)butyl]amino]-2,6-dimethyl-4-(4-nitrophenyl)-3,4-dihydropyridine-3-carboxylate |
| SMILES | COC(=O)C1C(C)=NC(C)=C(N(C=O)CCCCN2CCC(c3ccccc3)CC2)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H38N4O5/c1-22-28(31(37)40-3)29(26-11-13-27(14-12-26)35(38)39)30(23(2)32-22)34(21-36)18-8-7-17-33-19-15-25(16-20-33)24-9-5-4-6-10-24/h4-6,9-14,21,25,28-29H,7-8,15-20H2,1-3H3 |
| InChIKey | OCXINVCBOLBALB-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 105.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|