C28H33N5O5S — CID 15435251
methyl 6-methyl-4-(4-nitrophenyl)-3-[3-(4-phenylpiperidin-1-yl)propylcarbamoyl]-2-sulfanylidene-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 15435251) has the molecular formula C28H33N5O5S and a molecular weight of 551.67 g/mol. Its IUPAC name is methyl 6-methyl-4-(4-nitrophenyl)-3-[3-(4-phenylpiperidin-1-yl)propylcarbamoyl]-2-sulfanylidene-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | methyl 6-methyl-4-(4-nitrophenyl)-3-[3-(4-phenylpiperidin-1-yl)propylcarbamoyl]-2-sulfanylidene-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 15435251 |
| Molecular Formula | C28H33N5O5S |
| Molecular Weight | 551.67 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | methyl 6-methyl-4-(4-nitrophenyl)-3-[3-(4-phenylpiperidin-1-yl)propylcarbamoyl]-2-sulfanylidene-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(C)NC(=S)N(C(=O)NCCCN2CCC(c3ccccc3)CC2)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H33N5O5S/c1-19-24(26(34)38-2)25(22-9-11-23(12-10-22)33(36)37)32(28(39)30-19)27(35)29-15-6-16-31-17-13-21(14-18-31)20-7-4-3-5-8-20/h3-5,7-12,21,25H,6,13-18H2,1-2H3,(H,29,35)(H,30,39) |
| InChIKey | AMXXOCQXHJCNTK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 117.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.67 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|