C30H37N5O4 — CID 159167705
3-N,2,6-trimethyl-4-(4-nitrophenyl)-5-N-[3-(3-phenylpiperidin-1-yl)propyl]-1,4-dihydropyridine-3,5-dicarboxamide (PubChem CID 159167705) has the molecular formula C30H37N5O4 and a molecular weight of 531.66 g/mol. Its IUPAC name is 3-N,2,6-trimethyl-4-(4-nitrophenyl)-5-N-[3-(3-phenylpiperidin-1-yl)propyl]-1,4-dihydropyridine-3,5-dicarboxamide.
| Compound Name | 3-N,2,6-trimethyl-4-(4-nitrophenyl)-5-N-[3-(3-phenylpiperidin-1-yl)propyl]-1,4-dihydropyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 159167705 |
| Molecular Formula | C30H37N5O4 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | 3-N,2,6-trimethyl-4-(4-nitrophenyl)-5-N-[3-(3-phenylpiperidin-1-yl)propyl]-1,4-dihydropyridine-3,5-dicarboxamide |
| SMILES | CNC(=O)C1=C(C)NC(C)=C(C(=O)NCCCN2CCCC(c3ccccc3)C2)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H37N5O4/c1-20-26(29(36)31-3)28(23-12-14-25(15-13-23)35(38)39)27(21(2)33-20)30(37)32-16-8-18-34-17-7-11-24(19-34)22-9-5-4-6-10-22/h4-6,9-10,12-15,24,28,33H,7-8,11,16-19H2,1-3H3,(H,31,36)(H,32,37) |
| InChIKey | AGOGTBYKNBFQDK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|