C37H43N5O4 — CID 20642224
2-ethyl-6-methyl-3-N-[3-[4-(4-methylphenyl)-4-phenylpiperidin-1-yl]propyl]-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide (PubChem CID 20642224) has the molecular formula C37H43N5O4 and a molecular weight of 621.78 g/mol. Its IUPAC name is 2-ethyl-6-methyl-3-N-[3-[4-(4-methylphenyl)-4-phenylpiperidin-1-yl]propyl]-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide.
| Compound Name | 2-ethyl-6-methyl-3-N-[3-[4-(4-methylphenyl)-4-phenylpiperidin-1-yl]propyl]-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 20642224 |
| Molecular Formula | C37H43N5O4 |
| Molecular Weight | 621.78 g/mol |
| Exact Mass | 621.33 |
| IUPAC Name | 2-ethyl-6-methyl-3-N-[3-[4-(4-methylphenyl)-4-phenylpiperidin-1-yl]propyl]-4-(4-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxamide |
| SMILES | CCC1=C(C(=O)NCCCN2CCC(c3ccccc3)(c3ccc(C)cc3)CC2)C(c2ccc([N+](=O)[O-])cc2)C(C(N)=O)=C(C)N1 |
| InChI | InChI=1S/C37H43N5O4/c1-4-31-34(33(32(35(38)43)26(3)40-31)27-13-17-30(18-14-27)42(45)46)36(44)39-21-8-22-41-23-19-37(20-24-41,28-9-6-5-7-10-28)29-15-11-25(2)12-16-29/h5-7,9-18,33,40H,4,8,19-24H2,1-3H3,(H2,38,43)(H,39,44) |
| InChIKey | ZDCNEZVYDMUHIX-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 130.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.78 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|