C30H37N5O4 — CID 91930889
3-N,2,6-trimethyl-4-(4-nitrophenyl)-5-N-[3-(4-phenylpiperidin-1-yl)propyl]-3,4-dihydropyridine-3,5-dicarboxamide (PubChem CID 91930889) has the molecular formula C30H37N5O4 and a molecular weight of 531.66 g/mol. Its IUPAC name is 3-N,2,6-trimethyl-4-(4-nitrophenyl)-5-N-[3-(4-phenylpiperidin-1-yl)propyl]-3,4-dihydropyridine-3,5-dicarboxamide.
| Compound Name | 3-N,2,6-trimethyl-4-(4-nitrophenyl)-5-N-[3-(4-phenylpiperidin-1-yl)propyl]-3,4-dihydropyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 91930889 |
| Molecular Formula | C30H37N5O4 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | 3-N,2,6-trimethyl-4-(4-nitrophenyl)-5-N-[3-(4-phenylpiperidin-1-yl)propyl]-3,4-dihydropyridine-3,5-dicarboxamide |
| SMILES | CNC(=O)C1C(C)=NC(C)=C(C(=O)NCCCN2CCC(c3ccccc3)CC2)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H37N5O4/c1-20-26(29(36)31-3)28(24-10-12-25(13-11-24)35(38)39)27(21(2)33-20)30(37)32-16-7-17-34-18-14-23(15-19-34)22-8-5-4-6-9-22/h4-6,8-13,23,26,28H,7,14-19H2,1-3H3,(H,31,36)(H,32,37) |
| InChIKey | UVICRDSFJQQDJY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|