C35H45N5O6 — CID 90775301
ethyl 1-[3-[[2,6-diethyl-3-(methylcarbamoyl)-4-(4-nitrophenyl)-3,4-dihydropyridine-5-carbonyl]amino]propyl]-4-phenylpiperidine-4-carboxylate (PubChem CID 90775301) has the molecular formula C35H45N5O6 and a molecular weight of 631.77 g/mol. Its IUPAC name is ethyl 1-[3-[[2,6-diethyl-3-(methylcarbamoyl)-4-(4-nitrophenyl)-3,4-dihydropyridine-5-carbonyl]amino]propyl]-4-phenylpiperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-[[2,6-diethyl-3-(methylcarbamoyl)-4-(4-nitrophenyl)-3,4-dihydropyridine-5-carbonyl]amino]propyl]-4-phenylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 90775301 |
| Molecular Formula | C35H45N5O6 |
| Molecular Weight | 631.77 g/mol |
| Exact Mass | 631.34 |
| IUPAC Name | ethyl 1-[3-[[2,6-diethyl-3-(methylcarbamoyl)-4-(4-nitrophenyl)-3,4-dihydropyridine-5-carbonyl]amino]propyl]-4-phenylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(c2ccccc2)CCN(CCCNC(=O)C2=C(CC)N=C(CC)C(C(=O)NC)C2c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C35H45N5O6/c1-5-27-30(32(41)36-4)29(24-14-16-26(17-15-24)40(44)45)31(28(6-2)38-27)33(42)37-20-11-21-39-22-18-35(19-23-39,34(43)46-7-3)25-12-9-8-10-13-25/h8-10,12-17,29-30H,5-7,11,18-23H2,1-4H3,(H,36,41)(H,37,42) |
| InChIKey | TZPSKRUGSQHESR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 143.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.77 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|