C31H38N6O4 — CID 91610507
5-N-[3-(4-methanimidoyl-4-phenylpiperidin-1-yl)propyl]-3-N,2,6-trimethyl-4-(4-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxamide (PubChem CID 91610507) has the molecular formula C31H38N6O4 and a molecular weight of 558.68 g/mol. Its IUPAC name is 5-N-[3-(4-methanimidoyl-4-phenylpiperidin-1-yl)propyl]-3-N,2,6-trimethyl-4-(4-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxamide.
| Compound Name | 5-N-[3-(4-methanimidoyl-4-phenylpiperidin-1-yl)propyl]-3-N,2,6-trimethyl-4-(4-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 91610507 |
| Molecular Formula | C31H38N6O4 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | 5-N-[3-(4-methanimidoyl-4-phenylpiperidin-1-yl)propyl]-3-N,2,6-trimethyl-4-(4-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxamide |
| SMILES | [H]/N=C/C1(c2ccccc2)CCN(CCCNC(=O)C2=C(C)N=C(C)C(C(=O)NC)C2c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C31H38N6O4/c1-21-26(29(38)33-3)28(23-10-12-25(13-11-23)37(40)41)27(22(2)35-21)30(39)34-16-7-17-36-18-14-31(20-32,15-19-36)24-8-5-4-6-9-24/h4-6,8-13,20,26,28,32H,7,14-19H2,1-3H3,(H,33,38)(H,34,39)/b32-20+ |
| InChIKey | BSWZPIHTVXWYCZ-UZWMFBFFSA-N |
| XLogP | 3.98 |
| TPSA | 140.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|