C32H39FN4O4S — CID 10282073
dimethyl 4-[4-fluoro-3-[3-(4-phenylpiperidin-1-yl)propylcarbamothioylamino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 10282073) has the molecular formula C32H39FN4O4S and a molecular weight of 594.75 g/mol. Its IUPAC name is dimethyl 4-[4-fluoro-3-[3-(4-phenylpiperidin-1-yl)propylcarbamothioylamino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 4-[4-fluoro-3-[3-(4-phenylpiperidin-1-yl)propylcarbamothioylamino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10282073 |
| Molecular Formula | C32H39FN4O4S |
| Molecular Weight | 594.75 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | dimethyl 4-[4-fluoro-3-[3-(4-phenylpiperidin-1-yl)propylcarbamothioylamino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1ccc(F)c(NC(=S)NCCCN2CCC(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C32H39FN4O4S/c1-20-27(30(38)40-3)29(28(21(2)35-20)31(39)41-4)24-11-12-25(33)26(19-24)36-32(42)34-15-8-16-37-17-13-23(14-18-37)22-9-6-5-7-10-22/h5-7,9-12,19,23,29,35H,8,13-18H2,1-4H3,(H2,34,36,42) |
| InChIKey | DGXLITBGUWWJRX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.75 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|