C26H35FN4O4S — CID 22462253
4-[3-[3-(4-ethylpiperidin-1-yl)propylcarbamothioylamino]-4-fluorophenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid (PubChem CID 22462253) has the molecular formula C26H35FN4O4S and a molecular weight of 518.66 g/mol. Its IUPAC name is 4-[3-[3-(4-ethylpiperidin-1-yl)propylcarbamothioylamino]-4-fluorophenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid.
| Compound Name | 4-[3-[3-(4-ethylpiperidin-1-yl)propylcarbamothioylamino]-4-fluorophenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 22462253 |
| Molecular Formula | C26H35FN4O4S |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | 4-[3-[3-(4-ethylpiperidin-1-yl)propylcarbamothioylamino]-4-fluorophenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid |
| SMILES | CCC1CCN(CCCNC(=S)Nc2cc(C3C(C(=O)O)=C(C)NC(C)=C3C(=O)O)ccc2F)CC1 |
| InChI | InChI=1S/C26H35FN4O4S/c1-4-17-8-12-31(13-9-17)11-5-10-28-26(36)30-20-14-18(6-7-19(20)27)23-21(24(32)33)15(2)29-16(3)22(23)25(34)35/h6-7,14,17,23,29H,4-5,8-13H2,1-3H3,(H,32,33)(H,34,35)(H2,28,30,36) |
| InChIKey | GMIVLFSMHPOEFU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|