C25H33FN4O4S — CID 91284055
4-[4-fluoro-3-[3-(4-methylpiperidin-1-yl)propylcarbamothioylamino]phenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylic acid (PubChem CID 91284055) has the molecular formula C25H33FN4O4S and a molecular weight of 504.63 g/mol. Its IUPAC name is 4-[4-fluoro-3-[3-(4-methylpiperidin-1-yl)propylcarbamothioylamino]phenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylic acid.
| Compound Name | 4-[4-fluoro-3-[3-(4-methylpiperidin-1-yl)propylcarbamothioylamino]phenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 91284055 |
| Molecular Formula | C25H33FN4O4S |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 4-[4-fluoro-3-[3-(4-methylpiperidin-1-yl)propylcarbamothioylamino]phenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylic acid |
| SMILES | CC1=NC(C)=C(C(=O)O)C(c2ccc(F)c(NC(=S)NCCCN3CCC(C)CC3)c2)C1C(=O)O |
| InChI | InChI=1S/C25H33FN4O4S/c1-14-7-11-30(12-8-14)10-4-9-27-25(35)29-19-13-17(5-6-18(19)26)22-20(23(31)32)15(2)28-16(3)21(22)24(33)34/h5-6,13-14,20,22H,4,7-12H2,1-3H3,(H,31,32)(H,33,34)(H2,27,29,35) |
| InChIKey | FJWNBMJUVNATFD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|