C31H36N6O4 — CID 54196719
4-[3-[[N-cyano-N'-[3-(4-phenylpiperidin-1-yl)propyl]carbamimidoyl]amino]phenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylic acid (PubChem CID 54196719) has the molecular formula C31H36N6O4 and a molecular weight of 556.67 g/mol. Its IUPAC name is 4-[3-[[N-cyano-N'-[3-(4-phenylpiperidin-1-yl)propyl]carbamimidoyl]amino]phenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylic acid.
| Compound Name | 4-[3-[[N-cyano-N'-[3-(4-phenylpiperidin-1-yl)propyl]carbamimidoyl]amino]phenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 54196719 |
| Molecular Formula | C31H36N6O4 |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | 4-[3-[[N-cyano-N'-[3-(4-phenylpiperidin-1-yl)propyl]carbamimidoyl]amino]phenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylic acid |
| SMILES | CC1=NC(C)=C(C(=O)O)C(c2cccc(N/C(=N/CCCN3CCC(c4ccccc4)CC3)NC#N)c2)C1C(=O)O |
| InChI | InChI=1S/C31H36N6O4/c1-20-26(29(38)39)28(27(30(40)41)21(2)35-20)24-10-6-11-25(18-24)36-31(34-19-32)33-14-7-15-37-16-12-23(13-17-37)22-8-4-3-5-9-22/h3-6,8-11,18,23,26,28H,7,12-17H2,1-2H3,(H,38,39)(H,40,41)(H2,33,34,36) |
| InChIKey | PMIGXYMGUYEOPS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 150.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|