C33H41N7O4S — CID 91933129
dimethyl 4-[3-[[N-cyano-N'-[2-[[1-(2-methylsulfanylphenyl)piperidin-4-yl]amino]ethyl]carbamimidoyl]amino]phenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 91933129) has the molecular formula C33H41N7O4S and a molecular weight of 631.80 g/mol. Its IUPAC name is dimethyl 4-[3-[[N-cyano-N'-[2-[[1-(2-methylsulfanylphenyl)piperidin-4-yl]amino]ethyl]carbamimidoyl]amino]phenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 4-[3-[[N-cyano-N'-[2-[[1-(2-methylsulfanylphenyl)piperidin-4-yl]amino]ethyl]carbamimidoyl]amino]phenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 91933129 |
| Molecular Formula | C33H41N7O4S |
| Molecular Weight | 631.80 g/mol |
| Exact Mass | 631.29 |
| IUPAC Name | dimethyl 4-[3-[[N-cyano-N'-[2-[[1-(2-methylsulfanylphenyl)piperidin-4-yl]amino]ethyl]carbamimidoyl]amino]phenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)N=C(C)C(C(=O)OC)C1c1cccc(N/C(=N/CCNC2CCN(c3ccccc3SC)CC2)NC#N)c1 |
| InChI | InChI=1S/C33H41N7O4S/c1-21-28(31(41)43-3)30(29(22(2)38-21)32(42)44-4)23-9-8-10-25(19-23)39-33(37-20-34)36-16-15-35-24-13-17-40(18-14-24)26-11-6-7-12-27(26)45-5/h6-12,19,24,28,30,35H,13-18H2,1-5H3,(H2,36,37,39) |
| InChIKey | SQSXBSIMMAADAO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 140.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.80 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|