C29H39N7O4 — CID 19597365
4-[3-[[N-cyano-N'-[3-(4-cyclopentylpiperazin-1-yl)propyl]carbamimidoyl]amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid (PubChem CID 19597365) has the molecular formula C29H39N7O4 and a molecular weight of 549.68 g/mol. Its IUPAC name is 4-[3-[[N-cyano-N'-[3-(4-cyclopentylpiperazin-1-yl)propyl]carbamimidoyl]amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid.
| Compound Name | 4-[3-[[N-cyano-N'-[3-(4-cyclopentylpiperazin-1-yl)propyl]carbamimidoyl]amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 19597365 |
| Molecular Formula | C29H39N7O4 |
| Molecular Weight | 549.68 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | 4-[3-[[N-cyano-N'-[3-(4-cyclopentylpiperazin-1-yl)propyl]carbamimidoyl]amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2cccc(N/C(=N/CCCN3CCN(C4CCCC4)CC3)NC#N)c2)C(C(=O)O)=C(C)N1 |
| InChI | InChI=1S/C29H39N7O4/c1-19-24(27(37)38)26(25(28(39)40)20(2)33-19)21-7-5-8-22(17-21)34-29(32-18-30)31-11-6-12-35-13-15-36(16-14-35)23-9-3-4-10-23/h5,7-8,17,23,26,33H,3-4,6,9-16H2,1-2H3,(H,37,38)(H,39,40)(H2,31,32,34) |
| InChIKey | CWLWKPCOPAYKSK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.68 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|