C31H38N4O5 — CID 54537352
4-[3-[3-(4-benzylpiperidin-1-yl)propylcarbamoylamino]phenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylic acid (PubChem CID 54537352) has the molecular formula C31H38N4O5 and a molecular weight of 546.67 g/mol. Its IUPAC name is 4-[3-[3-(4-benzylpiperidin-1-yl)propylcarbamoylamino]phenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylic acid.
| Compound Name | 4-[3-[3-(4-benzylpiperidin-1-yl)propylcarbamoylamino]phenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 54537352 |
| Molecular Formula | C31H38N4O5 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | 4-[3-[3-(4-benzylpiperidin-1-yl)propylcarbamoylamino]phenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylic acid |
| SMILES | CC1=NC(C)=C(C(=O)O)C(c2cccc(NC(=O)NCCCN3CCC(Cc4ccccc4)CC3)c2)C1C(=O)O |
| InChI | InChI=1S/C31H38N4O5/c1-20-26(29(36)37)28(27(30(38)39)21(2)33-20)24-10-6-11-25(19-24)34-31(40)32-14-7-15-35-16-12-23(13-17-35)18-22-8-4-3-5-9-22/h3-6,8-11,19,23,26,28H,7,12-18H2,1-2H3,(H,36,37)(H,38,39)(H2,32,34,40) |
| InChIKey | ZASHDLQTECYPFX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 131.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|