C21H25Cl2N3O — CID 110173334
1-(3,4-dichlorophenyl)-3-[3-(4-phenylpiperidin-1-yl)propyl]urea (PubChem CID 110173334) has the molecular formula C21H25Cl2N3O and a molecular weight of 406.36 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[3-(4-phenylpiperidin-1-yl)propyl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[3-(4-phenylpiperidin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 110173334 |
| Molecular Formula | C21H25Cl2N3O |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[3-(4-phenylpiperidin-1-yl)propyl]urea |
| SMILES | O=C(NCCCN1CCC(c2ccccc2)CC1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H25Cl2N3O/c22-19-8-7-18(15-20(19)23)25-21(27)24-11-4-12-26-13-9-17(10-14-26)16-5-2-1-3-6-16/h1-3,5-8,15,17H,4,9-14H2,(H2,24,25,27) |
| InChIKey | FJBCTJFVUVUYOM-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|