C33H41N5O7 — CID 54100668
4-[3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylcarbamoylamino]-4-prop-2-enoxyphenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylic acid (PubChem CID 54100668) has the molecular formula C33H41N5O7 and a molecular weight of 619.72 g/mol. Its IUPAC name is 4-[3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylcarbamoylamino]-4-prop-2-enoxyphenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylic acid.
| Compound Name | 4-[3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylcarbamoylamino]-4-prop-2-enoxyphenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 54100668 |
| Molecular Formula | C33H41N5O7 |
| Molecular Weight | 619.72 g/mol |
| Exact Mass | 619.30 |
| IUPAC Name | 4-[3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylcarbamoylamino]-4-prop-2-enoxyphenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylic acid |
| SMILES | C=CCOc1ccc(C2C(C(=O)O)=C(C)N=C(C)C2C(=O)O)cc1NC(=O)NCCCN1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C33H41N5O7/c1-5-19-45-26-12-11-23(30-28(31(39)40)21(2)35-22(3)29(30)32(41)42)20-24(26)36-33(43)34-13-8-14-37-15-17-38(18-16-37)25-9-6-7-10-27(25)44-4/h5-7,9-12,20,28,30H,1,8,13-19H2,2-4H3,(H,39,40)(H,41,42)(H2,34,36,43) |
| InChIKey | NAHHCZSNSABLMI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 153.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.72 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|