C31H39N5O5 — CID 57292953
N-[2,6-diethyl-5-[formyl-[3-(4-hydroxy-4-phenylpiperidin-1-yl)propyl]amino]-4-(4-nitrophenyl)-3,4-dihydropyridin-3-yl]formamide (PubChem CID 57292953) has the molecular formula C31H39N5O5 and a molecular weight of 561.68 g/mol. Its IUPAC name is N-[2,6-diethyl-5-[formyl-[3-(4-hydroxy-4-phenylpiperidin-1-yl)propyl]amino]-4-(4-nitrophenyl)-3,4-dihydropyridin-3-yl]formamide.
| Compound Name | N-[2,6-diethyl-5-[formyl-[3-(4-hydroxy-4-phenylpiperidin-1-yl)propyl]amino]-4-(4-nitrophenyl)-3,4-dihydropyridin-3-yl]formamide |
|---|---|
| PubChem CID | 57292953 |
| Molecular Formula | C31H39N5O5 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.30 |
| IUPAC Name | N-[2,6-diethyl-5-[formyl-[3-(4-hydroxy-4-phenylpiperidin-1-yl)propyl]amino]-4-(4-nitrophenyl)-3,4-dihydropyridin-3-yl]formamide |
| SMILES | CCC1=NC(CC)=C(N(C=O)CCCN2CCC(O)(c3ccccc3)CC2)C(c2ccc([N+](=O)[O-])cc2)C1NC=O |
| InChI | InChI=1S/C31H39N5O5/c1-3-26-29(32-21-37)28(23-11-13-25(14-12-23)36(40)41)30(27(4-2)33-26)35(22-38)18-8-17-34-19-15-31(39,16-20-34)24-9-6-5-7-10-24/h5-7,9-14,21-22,28-29,39H,3-4,8,15-20H2,1-2H3,(H,32,37) |
| InChIKey | XVRRQUUGJNZYTI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 128.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|