C39H46N4O5 — CID 54455832
5-[3-(4,4-diphenylpiperidin-1-yl)propyl-formylamino]-4-(4-nitrophenyl)-2,6-dipropyl-2,3-dihydropyridine-3-carboxylic acid (PubChem CID 54455832) has the molecular formula C39H46N4O5 and a molecular weight of 650.82 g/mol. Its IUPAC name is 5-[3-(4,4-diphenylpiperidin-1-yl)propyl-formylamino]-4-(4-nitrophenyl)-2,6-dipropyl-2,3-dihydropyridine-3-carboxylic acid.
| Compound Name | 5-[3-(4,4-diphenylpiperidin-1-yl)propyl-formylamino]-4-(4-nitrophenyl)-2,6-dipropyl-2,3-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 54455832 |
| Molecular Formula | C39H46N4O5 |
| Molecular Weight | 650.82 g/mol |
| Exact Mass | 650.35 |
| IUPAC Name | 5-[3-(4,4-diphenylpiperidin-1-yl)propyl-formylamino]-4-(4-nitrophenyl)-2,6-dipropyl-2,3-dihydropyridine-3-carboxylic acid |
| SMILES | CCCC1=NC(CCC)C(C(=O)O)C(c2ccc([N+](=O)[O-])cc2)=C1N(C=O)CCCN1CCC(c2ccccc2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C39H46N4O5/c1-3-12-33-36(38(45)46)35(29-18-20-32(21-19-29)43(47)48)37(34(40-33)13-4-2)42(28-44)25-11-24-41-26-22-39(23-27-41,30-14-7-5-8-15-30)31-16-9-6-10-17-31/h5-10,14-21,28,33,36H,3-4,11-13,22-27H2,1-2H3,(H,45,46) |
| InChIKey | WYCXBSDGAAEOPR-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 116.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.82 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|