C33H36N4O5 — CID 15462007
methyl 3-[5-(4,4-diphenylpiperidin-1-yl)pentyl]-4-(4-nitrophenyl)-2-oxo-1H-imidazole-5-carboxylate (PubChem CID 15462007) has the molecular formula C33H36N4O5 and a molecular weight of 568.67 g/mol. Its IUPAC name is methyl 3-[5-(4,4-diphenylpiperidin-1-yl)pentyl]-4-(4-nitrophenyl)-2-oxo-1H-imidazole-5-carboxylate.
| Compound Name | methyl 3-[5-(4,4-diphenylpiperidin-1-yl)pentyl]-4-(4-nitrophenyl)-2-oxo-1H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 15462007 |
| Molecular Formula | C33H36N4O5 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | methyl 3-[5-(4,4-diphenylpiperidin-1-yl)pentyl]-4-(4-nitrophenyl)-2-oxo-1H-imidazole-5-carboxylate |
| SMILES | COC(=O)c1[nH]c(=O)n(CCCCCN2CCC(c3ccccc3)(c3ccccc3)CC2)c1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C33H36N4O5/c1-42-31(38)29-30(25-15-17-28(18-16-25)37(40)41)36(32(39)34-29)22-10-4-9-21-35-23-19-33(20-24-35,26-11-5-2-6-12-26)27-13-7-3-8-14-27/h2-3,5-8,11-18H,4,9-10,19-24H2,1H3,(H,34,39) |
| InChIKey | ZEUCEJRNVKKGKI-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 110.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|