C34H37F2N3O3 — CID 15462009
methyl 4-[(3,4-difluorophenyl)methyl]-3-[5-(4,4-diphenylpiperidin-1-yl)pentyl]-2-oxo-1H-imidazole-5-carboxylate (PubChem CID 15462009) has the molecular formula C34H37F2N3O3 and a molecular weight of 573.68 g/mol. Its IUPAC name is methyl 4-[(3,4-difluorophenyl)methyl]-3-[5-(4,4-diphenylpiperidin-1-yl)pentyl]-2-oxo-1H-imidazole-5-carboxylate.
| Compound Name | methyl 4-[(3,4-difluorophenyl)methyl]-3-[5-(4,4-diphenylpiperidin-1-yl)pentyl]-2-oxo-1H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 15462009 |
| Molecular Formula | C34H37F2N3O3 |
| Molecular Weight | 573.68 g/mol |
| Exact Mass | 573.28 |
| IUPAC Name | methyl 4-[(3,4-difluorophenyl)methyl]-3-[5-(4,4-diphenylpiperidin-1-yl)pentyl]-2-oxo-1H-imidazole-5-carboxylate |
| SMILES | COC(=O)c1[nH]c(=O)n(CCCCCN2CCC(c3ccccc3)(c3ccccc3)CC2)c1Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C34H37F2N3O3/c1-42-32(40)31-30(24-25-15-16-28(35)29(36)23-25)39(33(41)37-31)20-10-4-9-19-38-21-17-34(18-22-38,26-11-5-2-6-12-26)27-13-7-3-8-14-27/h2-3,5-8,11-16,23H,4,9-10,17-22,24H2,1H3,(H,37,41) |
| InChIKey | UPZDELYFBWAAPA-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.68 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|