C31H37FN3O2P — CID 142000825
N-[3-(4,4-diphenylpiperidin-1-yl)propyl]-3-(4-fluoro-3-phosphanylphenyl)morpholine-4-carboxamide (PubChem CID 142000825) has the molecular formula C31H37FN3O2P and a molecular weight of 533.63 g/mol. Its IUPAC name is N-[3-(4,4-diphenylpiperidin-1-yl)propyl]-3-(4-fluoro-3-phosphanylphenyl)morpholine-4-carboxamide.
| Compound Name | N-[3-(4,4-diphenylpiperidin-1-yl)propyl]-3-(4-fluoro-3-phosphanylphenyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 142000825 |
| Molecular Formula | C31H37FN3O2P |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | N-[3-(4,4-diphenylpiperidin-1-yl)propyl]-3-(4-fluoro-3-phosphanylphenyl)morpholine-4-carboxamide |
| SMILES | O=C(NCCCN1CCC(c2ccccc2)(c2ccccc2)CC1)N1CCOCC1c1ccc(F)c(P)c1 |
| InChI | InChI=1S/C31H37FN3O2P/c32-27-13-12-24(22-29(27)38)28-23-37-21-20-35(28)30(36)33-16-7-17-34-18-14-31(15-19-34,25-8-3-1-4-9-25)26-10-5-2-6-11-26/h1-6,8-13,22,28H,7,14-21,23,38H2,(H,33,36) |
| InChIKey | XRXIUPGUSWPFRC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|