C30H28ClF2N3O4 — CID 10281391
(4S)-N-[3-(2'-chlorospiro[piperidine-4,9'-xanthene]-1-yl)propyl]-4-(3,4-difluorophenyl)-2-oxo-1,3-oxazolidine-3-carboxamide (PubChem CID 10281391) has the molecular formula C30H28ClF2N3O4 and a molecular weight of 568.02 g/mol. Its IUPAC name is (4S)-N-[3-(2'-chlorospiro[piperidine-4,9'-xanthene]-1-yl)propyl]-4-(3,4-difluorophenyl)-2-oxo-1,3-oxazolidine-3-carboxamide.
| Compound Name | (4S)-N-[3-(2'-chlorospiro[piperidine-4,9'-xanthene]-1-yl)propyl]-4-(3,4-difluorophenyl)-2-oxo-1,3-oxazolidine-3-carboxamide |
|---|---|
| PubChem CID | 10281391 |
| Molecular Formula | C30H28ClF2N3O4 |
| Molecular Weight | 568.02 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | (4S)-N-[3-(2'-chlorospiro[piperidine-4,9'-xanthene]-1-yl)propyl]-4-(3,4-difluorophenyl)-2-oxo-1,3-oxazolidine-3-carboxamide |
| SMILES | O=C(NCCCN1CCC2(CC1)c1ccccc1Oc1ccc(Cl)cc12)N1C(=O)OC[C@@H]1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C30H28ClF2N3O4/c31-20-7-9-27-22(17-20)30(21-4-1-2-5-26(21)40-27)10-14-35(15-11-30)13-3-12-34-28(37)36-25(18-39-29(36)38)19-6-8-23(32)24(33)16-19/h1-2,4-9,16-17,25H,3,10-15,18H2,(H,34,37)/t25-/m1/s1 |
| InChIKey | XURPCIRBCXVTDW-RUZDIDTESA-N |
| XLogP | 6.40 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.02 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|